C14H15IN2O3S — CID 106030152
3-(aminomethyl)-N-(2-iodophenyl)-4-methoxybenzenesulfonamide (PubChem CID 106030152) has the molecular formula C14H15IN2O3S and a molecular weight of 418.26 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-iodophenyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-(2-iodophenyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106030152 |
| Molecular Formula | C14H15IN2O3S |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 3-(aminomethyl)-N-(2-iodophenyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2I)cc1CN |
| InChI | InChI=1S/C14H15IN2O3S/c1-20-14-7-6-11(8-10(14)9-16)21(18,19)17-13-5-3-2-4-12(13)15/h2-8,17H,9,16H2,1H3 |
| InChIKey | YJADZZGXWWNNAS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|