C13H19N5O2S — CID 106031016
3-(ethylaminomethyl)-5-methyl-N-(pyridin-4-ylmethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 106031016) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-5-methyl-N-(pyridin-4-ylmethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(ethylaminomethyl)-5-methyl-N-(pyridin-4-ylmethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106031016 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-(ethylaminomethyl)-5-methyl-N-(pyridin-4-ylmethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCNCc1n[nH]c(C)c1S(=O)(=O)NCc1ccncc1 |
| InChI | InChI=1S/C13H19N5O2S/c1-3-14-9-12-13(10(2)17-18-12)21(19,20)16-8-11-4-6-15-7-5-11/h4-7,14,16H,3,8-9H2,1-2H3,(H,17,18) |
| InChIKey | XFRIXCNMMWUWEQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |