C11H16N4O2S2 — CID 106070171
3-(ethylaminomethyl)-5-methyl-N-thiophen-3-yl-1H-pyrazole-4-sulfonamide (PubChem CID 106070171) has the molecular formula C11H16N4O2S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-5-methyl-N-thiophen-3-yl-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(ethylaminomethyl)-5-methyl-N-thiophen-3-yl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106070171 |
| Molecular Formula | C11H16N4O2S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-(ethylaminomethyl)-5-methyl-N-thiophen-3-yl-1H-pyrazole-4-sulfonamide |
| SMILES | CCNCc1n[nH]c(C)c1S(=O)(=O)Nc1ccsc1 |
| InChI | InChI=1S/C11H16N4O2S2/c1-3-12-6-10-11(8(2)13-14-10)19(16,17)15-9-4-5-18-7-9/h4-5,7,12,15H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | JTOVFRDMMZYCOH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |