C13H16FN3O2S2 — CID 106031681
2-fluoro-5-(propylaminomethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 106031681) has the molecular formula C13H16FN3O2S2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-fluoro-5-(propylaminomethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-5-(propylaminomethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106031681 |
| Molecular Formula | C13H16FN3O2S2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-fluoro-5-(propylaminomethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCCNCc1ccc(F)c(S(=O)(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C13H16FN3O2S2/c1-2-5-15-9-10-3-4-11(14)12(8-10)21(18,19)17-13-16-6-7-20-13/h3-4,6-8,15H,2,5,9H2,1H3,(H,16,17) |
| InChIKey | LPYBXGHIYDMXJJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|