C35H34N2O2S2 — CID 10603299
(4R,5S)-5-phenyl-2-[2-[(4R,5S)-5-phenyl-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 10603299) has the molecular formula C35H34N2O2S2 and a molecular weight of 578.80 g/mol. Its IUPAC name is (4R,5S)-5-phenyl-2-[2-[(4R,5S)-5-phenyl-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5S)-5-phenyl-2-[2-[(4R,5S)-5-phenyl-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10603299 |
| Molecular Formula | C35H34N2O2S2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (4R,5S)-5-phenyl-2-[2-[(4R,5S)-5-phenyl-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C1=N[C@@H](CSc2ccccc2)[C@H](c2ccccc2)O1)C1=N[C@@H](CSc2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C35H34N2O2S2/c1-35(2,33-36-29(23-40-27-19-11-5-12-20-27)31(38-33)25-15-7-3-8-16-25)34-37-30(24-41-28-21-13-6-14-22-28)32(39-34)26-17-9-4-10-18-26/h3-22,29-32H,23-24H2,1-2H3/t29-,30-,31-,32-/m0/s1 |
| InChIKey | OGDGXLXVTXVEBL-YDPTYEFTSA-N |
| XLogP | 8.67 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |