C13H14BrNOS — CID 106033321
1-[2-(5-bromothiophen-2-yl)ethyl]-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 106033321) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 106033321 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1CCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H14BrNOS/c1-9-7-11(8-16)10(2)15(9)6-5-12-3-4-13(14)17-12/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | SKLFOMIFEXUMOA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|