C13H15BrN4OS — CID 106033606
4-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5-cyclopropyl-1H-pyrazole-3-carboxamide (PubChem CID 106033606) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 4-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5-cyclopropyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5-cyclopropyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 106033606 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 4-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5-cyclopropyl-1H-pyrazole-3-carboxamide |
| SMILES | Nc1c(C(=O)NCCc2ccc(Br)s2)n[nH]c1C1CC1 |
| InChI | InChI=1S/C13H15BrN4OS/c14-9-4-3-8(20-9)5-6-16-13(19)12-10(15)11(17-18-12)7-1-2-7/h3-4,7H,1-2,5-6,15H2,(H,16,19)(H,17,18) |
| InChIKey | ZOMBSUWMWONZKQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |