C10H9BrN4O2S2 — CID 75440262
N-[2-(5-bromothiophen-2-yl)ethyl]-5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxamide (PubChem CID 75440262) has the molecular formula C10H9BrN4O2S2 and a molecular weight of 361.25 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 75440262 |
| Molecular Formula | C10H9BrN4O2S2 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxamide |
| SMILES | O=C(NCCc1ccc(Br)s1)c1n[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C10H9BrN4O2S2/c11-6-2-1-5(19-6)3-4-12-8(16)7-9(17)13-10(18)15-14-7/h1-2H,3-4H2,(H,12,16)(H2,13,15,17,18) |
| InChIKey | VHUBKNHILIKLNW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|