C8H8BrN3S3 — CID 106037873
5-[2-(5-bromothiophen-2-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 106037873) has the molecular formula C8H8BrN3S3 and a molecular weight of 322.28 g/mol. Its IUPAC name is 5-[2-(5-bromothiophen-2-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-(5-bromothiophen-2-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 106037873 |
| Molecular Formula | C8H8BrN3S3 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 320.91 |
| IUPAC Name | 5-[2-(5-bromothiophen-2-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(NCCc2ccc(Br)s2)s1 |
| InChI | InChI=1S/C8H8BrN3S3/c9-6-2-1-5(14-6)3-4-10-7-11-12-8(13)15-7/h1-2H,3-4H2,(H,10,11)(H,12,13) |
| InChIKey | OEOPKCGGDGISAF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|