C5H9N3S3 — CID 63957767
5-(2-methylsulfanylethylamino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 63957767) has the molecular formula C5H9N3S3 and a molecular weight of 207.35 g/mol. Its IUPAC name is 5-(2-methylsulfanylethylamino)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(2-methylsulfanylethylamino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 63957767 |
| Molecular Formula | C5H9N3S3 |
| Molecular Weight | 207.35 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 5-(2-methylsulfanylethylamino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CSCCNc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C5H9N3S3/c1-10-3-2-6-4-7-8-5(9)11-4/h2-3H2,1H3,(H,6,7)(H,8,9) |
| InChIKey | RIHWKXCJGSQYNY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|