C9H8BrN3O2S2 — CID 103095288
N-[2-(5-bromothiophen-2-yl)ethyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 103095288) has the molecular formula C9H8BrN3O2S2 and a molecular weight of 334.22 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103095288 |
| Molecular Formula | C9H8BrN3O2S2 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 332.92 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCCc2ccc(Br)s2)s1 |
| InChI | InChI=1S/C9H8BrN3O2S2/c10-7-2-1-6(16-7)3-4-11-9-12-5-8(17-9)13(14)15/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | AVXDOZUECFILBA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|