C12H10BrN3S — CID 114139101
4-[2-(5-bromothiophen-2-yl)ethylamino]pyridine-2-carbonitrile (PubChem CID 114139101) has the molecular formula C12H10BrN3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 4-[2-(5-bromothiophen-2-yl)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 4-[2-(5-bromothiophen-2-yl)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 114139101 |
| Molecular Formula | C12H10BrN3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 4-[2-(5-bromothiophen-2-yl)ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(NCCc2ccc(Br)s2)ccn1 |
| InChI | InChI=1S/C12H10BrN3S/c13-12-2-1-11(17-12)4-6-15-9-3-5-16-10(7-9)8-14/h1-3,5,7H,4,6H2,(H,15,16) |
| InChIKey | WMCVRLZAZSHURH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |