C8H10N4S3 — CID 106037867
5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 106037867) has the molecular formula C8H10N4S3 and a molecular weight of 258.40 g/mol. Its IUPAC name is 5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 106037867 |
| Molecular Formula | C8H10N4S3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1nc(CCNc2n[nH]c(=S)s2)cs1 |
| InChI | InChI=1S/C8H10N4S3/c1-5-10-6(4-14-5)2-3-9-7-11-12-8(13)15-7/h4H,2-3H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | YLPROGOGCLDJDH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|