C9H10ClN3OS2 — CID 106033962
4-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 106033962) has the molecular formula C9H10ClN3OS2 and a molecular weight of 275.79 g/mol. Its IUPAC name is 4-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106033962 |
| Molecular Formula | C9H10ClN3OS2 |
| Molecular Weight | 275.79 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 4-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | OCc1n[nH]c(=S)n1CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H10ClN3OS2/c10-7-2-1-6(16-7)3-4-13-8(5-14)11-12-9(13)15/h1-2,14H,3-5H2,(H,12,15) |
| InChIKey | HRJPPYJVDPCABJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|