C16H16ClN3O2S2 — CID 17285000
3-(5-chlorothiophen-2-yl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 17285000) has the molecular formula C16H16ClN3O2S2 and a molecular weight of 381.91 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-chlorothiophen-2-yl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17285000 |
| Molecular Formula | C16H16ClN3O2S2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(CCn2c(-c3ccc(Cl)s3)n[nH]c2=S)cc1OC |
| InChI | InChI=1S/C16H16ClN3O2S2/c1-21-11-4-3-10(9-12(11)22-2)7-8-20-15(18-19-16(20)23)13-5-6-14(17)24-13/h3-6,9H,7-8H2,1-2H3,(H,19,23) |
| InChIKey | KUNKXBRGBQDVNE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|