C23H29N3O11S — CID 10603536
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-[(2-carbamimidoylsulfanylacetyl)amino]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 10603536) has the molecular formula C23H29N3O11S and a molecular weight of 555.56 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-[(2-carbamimidoylsulfanylacetyl)amino]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-[(2-carbamimidoylsulfanylacetyl)amino]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10603536 |
| Molecular Formula | C23H29N3O11S |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-[(2-carbamimidoylsulfanylacetyl)amino]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(\N)SCC(=O)Nc1ccc(O[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C23H29N3O11S/c1-11(27)32-9-17-19(33-12(2)28)20(34-13(3)29)21(35-14(4)30)22(37-17)36-16-7-5-15(6-8-16)26-18(31)10-38-23(24)25/h5-8,17,19-22H,9-10H2,1-4H3,(H3,24,25)(H,26,31)/t17-,19-,20+,21+,22+/m1/s1 |
| InChIKey | ZWHPQEMOCJPATG-ICGSVKGVSA-N |
| XLogP | 0.71 |
| TPSA | 202.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|