C15H20N4S2 — CID 106036052
2-[(1,5-dimethylpyrazol-4-yl)methylamino]-6-ethylsulfanylbenzenecarbothioamide (PubChem CID 106036052) has the molecular formula C15H20N4S2 and a molecular weight of 320.49 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrazol-4-yl)methylamino]-6-ethylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[(1,5-dimethylpyrazol-4-yl)methylamino]-6-ethylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106036052 |
| Molecular Formula | C15H20N4S2 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[(1,5-dimethylpyrazol-4-yl)methylamino]-6-ethylsulfanylbenzenecarbothioamide |
| SMILES | CCSc1cccc(NCc2cnn(C)c2C)c1C(N)=S |
| InChI | InChI=1S/C15H20N4S2/c1-4-21-13-7-5-6-12(14(13)15(16)20)17-8-11-9-18-19(3)10(11)2/h5-7,9,17H,4,8H2,1-3H3,(H2,16,20) |
| InChIKey | VWMWDAGHXMNOSD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|