C15H17ClN2S3 — CID 106036538
2-[2-(5-chlorothiophen-2-yl)ethylamino]-6-ethylsulfanylbenzenecarbothioamide (PubChem CID 106036538) has the molecular formula C15H17ClN2S3 and a molecular weight of 356.97 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)ethylamino]-6-ethylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)ethylamino]-6-ethylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106036538 |
| Molecular Formula | C15H17ClN2S3 |
| Molecular Weight | 356.97 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)ethylamino]-6-ethylsulfanylbenzenecarbothioamide |
| SMILES | CCSc1cccc(NCCc2ccc(Cl)s2)c1C(N)=S |
| InChI | InChI=1S/C15H17ClN2S3/c1-2-20-12-5-3-4-11(14(12)15(17)19)18-9-8-10-6-7-13(16)21-10/h3-7,18H,2,8-9H2,1H3,(H2,17,19) |
| InChIKey | MLQYPEMZZYFFKD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|