C12H16N4O3 — CID 106037684
2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]pent-4-ynoic acid (PubChem CID 106037684) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]pent-4-ynoic acid.
| Compound Name | 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 106037684 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)NCc1cnn(C)c1C)C(=O)O |
| InChI | InChI=1S/C12H16N4O3/c1-4-5-10(11(17)18)15-12(19)13-6-9-7-14-16(3)8(9)2/h1,7,10H,5-6H2,2-3H3,(H,17,18)(H2,13,15,19) |
| InChIKey | DEEYDUKPZNBEJC-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|