C9H7BrN2O3S — CID 106038807
1-[2-(5-bromothiophen-2-yl)ethyl]imidazolidine-2,4,5-trione (PubChem CID 106038807) has the molecular formula C9H7BrN2O3S and a molecular weight of 303.14 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 106038807 |
| Molecular Formula | C9H7BrN2O3S |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(CCc2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C9H7BrN2O3S/c10-6-2-1-5(16-6)3-4-12-8(14)7(13)11-9(12)15/h1-2H,3-4H2,(H,11,13,15) |
| InChIKey | UBDAQKGPZLZQSG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|