C14H17BrN2O3S — CID 106040744
1-[2-(5-bromothiophen-2-yl)ethyl]-5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 106040744) has the molecular formula C14H17BrN2O3S and a molecular weight of 373.27 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 106040744 |
| Molecular Formula | C14H17BrN2O3S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(CCc2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C14H17BrN2O3S/c1-3-14(4-2)11(18)16-13(20)17(12(14)19)8-7-9-5-6-10(15)21-9/h5-6H,3-4,7-8H2,1-2H3,(H,16,18,20) |
| InChIKey | BQFTXULGCDUGIE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|