C9H15BrN2S — CID 106042832
N'-[2-(5-bromothiophen-2-yl)ethyl]propane-1,3-diamine (PubChem CID 106042832) has the molecular formula C9H15BrN2S and a molecular weight of 263.20 g/mol. Its IUPAC name is N'-[2-(5-bromothiophen-2-yl)ethyl]propane-1,3-diamine.
| Compound Name | N'-[2-(5-bromothiophen-2-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 106042832 |
| Molecular Formula | C9H15BrN2S |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | N'-[2-(5-bromothiophen-2-yl)ethyl]propane-1,3-diamine |
| SMILES | NCCCNCCc1ccc(Br)s1 |
| InChI | InChI=1S/C9H15BrN2S/c10-9-3-2-8(13-9)4-7-12-6-1-5-11/h2-3,12H,1,4-7,11H2 |
| InChIKey | UEOONLJPVJYLHO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|