C14H24BrN3OS — CID 106034246
6-[2-(5-bromothiophen-2-yl)ethylamino]-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106034246) has the molecular formula C14H24BrN3OS and a molecular weight of 362.34 g/mol. Its IUPAC name is 6-[2-(5-bromothiophen-2-yl)ethylamino]-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-[2-(5-bromothiophen-2-yl)ethylamino]-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106034246 |
| Molecular Formula | C14H24BrN3OS |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 6-[2-(5-bromothiophen-2-yl)ethylamino]-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCNCCc1ccc(Br)s1)/C(N)=N/O |
| InChI | InChI=1S/C14H24BrN3OS/c1-14(2,13(16)18-19)8-3-4-9-17-10-7-11-5-6-12(15)20-11/h5-6,17,19H,3-4,7-10H2,1-2H3,(H2,16,18) |
| InChIKey | VLVPSYSFPLQOAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|