C13H19N3O2S — CID 106044300
3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 106044300) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106044300 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | Cc1nc(CCNC2CC(=O)N(C(C)C)C2=O)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-8(2)16-12(17)6-11(13(16)18)14-5-4-10-7-19-9(3)15-10/h7-8,11,14H,4-6H2,1-3H3 |
| InChIKey | OQPRABDKKJQJTF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|