About 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione
3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 106044300) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione |
| PubChem CID | 106044300 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | Cc1nc(CCNC2CC(=O)N(C(C)C)C2=O)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-8(2)16-12(17)6-11(13(16)18)14-5-4-10-7-19-9(3)15-10/h7-8,11,14H,4-6H2,1-3H3 |
| InChIKey | OQPRABDKKJQJTF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione?
The IUPAC name of 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione (CID 106044300) is 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione.
What is the SMILES notation for 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione?
The canonical SMILES for 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione is Cc1nc(CCNC2CC(=O)N(C(C)C)C2=O)cs1.
What is the InChIKey of 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione?
The InChIKey is OQPRABDKKJQJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S/c1-8(2)16-12(17)6-11(13(16)18)14-5-4-10-7-19-9(3)15-10/h7-8,11,14H,4-6H2,1-3H3.
What are the key properties of 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione?
3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione has a molecular weight of 281.38 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-1-propan-2-ylpyrrolidine-2,5-dione is sourced from PubChem (CID 106044300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).