C15H22N2O2S — CID 80526495
3-[(2-methyl-2-thiophen-2-ylpropyl)amino]-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 80526495) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-[(2-methyl-2-thiophen-2-ylpropyl)amino]-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(2-methyl-2-thiophen-2-ylpropyl)amino]-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 80526495 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[(2-methyl-2-thiophen-2-ylpropyl)amino]-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)N1C(=O)CC(NCC(C)(C)c2cccs2)C1=O |
| InChI | InChI=1S/C15H22N2O2S/c1-10(2)17-13(18)8-11(14(17)19)16-9-15(3,4)12-6-5-7-20-12/h5-7,10-11,16H,8-9H2,1-4H3 |
| InChIKey | LIMPORATSBMSBE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|