C14H14BrFN2OS — CID 106046896
2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(3-fluorophenyl)acetamide (PubChem CID 106046896) has the molecular formula C14H14BrFN2OS and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 106046896 |
| Molecular Formula | C14H14BrFN2OS |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(CNCCc1ccc(Br)s1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H14BrFN2OS/c15-13-5-4-12(20-13)6-7-17-9-14(19)18-11-3-1-2-10(16)8-11/h1-5,8,17H,6-7,9H2,(H,18,19) |
| InChIKey | KWRYUMUONDXZAH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|