C14H19FN2O2 — CID 106401479
2-(2-but-3-enoxyethylamino)-N-(3-fluorophenyl)acetamide (PubChem CID 106401479) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(2-but-3-enoxyethylamino)-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-(2-but-3-enoxyethylamino)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 106401479 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(2-but-3-enoxyethylamino)-N-(3-fluorophenyl)acetamide |
| SMILES | C=CCCOCCNCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H19FN2O2/c1-2-3-8-19-9-7-16-11-14(18)17-13-6-4-5-12(15)10-13/h2,4-6,10,16H,1,3,7-9,11H2,(H,17,18) |
| InChIKey | DFDGFOCVQLTZLO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|