C11H14BrN3S — CID 106047077
2-(5-bromothiophen-2-yl)-N-(2-pyrazol-1-ylethyl)ethanamine (PubChem CID 106047077) has the molecular formula C11H14BrN3S and a molecular weight of 300.22 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-(2-pyrazol-1-ylethyl)ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-(2-pyrazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 106047077 |
| Molecular Formula | C11H14BrN3S |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-(2-pyrazol-1-ylethyl)ethanamine |
| SMILES | Brc1ccc(CCNCCn2cccn2)s1 |
| InChI | InChI=1S/C11H14BrN3S/c12-11-3-2-10(16-11)4-6-13-7-9-15-8-1-5-14-15/h1-3,5,8,13H,4,6-7,9H2 |
| InChIKey | MHCRNWADRXGZHL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|