C15H15BrClNOS — CID 106047182
2-(5-bromothiophen-2-yl)-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]ethanamine (PubChem CID 106047182) has the molecular formula C15H15BrClNOS and a molecular weight of 372.72 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106047182 |
| Molecular Formula | C15H15BrClNOS |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]ethanamine |
| SMILES | Clc1cc2c(c(CNCCc3ccc(Br)s3)c1)OCC2 |
| InChI | InChI=1S/C15H15BrClNOS/c16-14-2-1-13(20-14)3-5-18-9-11-8-12(17)7-10-4-6-19-15(10)11/h1-2,7-8,18H,3-6,9H2 |
| InChIKey | ZZQANCSJMZQRID-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|