C14H19Cl2NO2 — CID 106242783
3-chloro-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-methoxybutan-1-amine (PubChem CID 106242783) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-methoxybutan-1-amine.
| Compound Name | 3-chloro-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 106242783 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-chloro-N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-methoxybutan-1-amine |
| SMILES | COCC(Cl)CCNCc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C14H19Cl2NO2/c1-18-9-12(15)2-4-17-8-11-7-13(16)6-10-3-5-19-14(10)11/h6-7,12,17H,2-5,8-9H2,1H3 |
| InChIKey | DFRKTJZLGIJSLU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|