C15H18ClNO — CID 106230137
N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]hex-1-yn-3-amine (PubChem CID 106230137) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]hex-1-yn-3-amine.
| Compound Name | N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106230137 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NCc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C15H18ClNO/c1-3-5-14(4-2)17-10-12-9-13(16)8-11-6-7-18-15(11)12/h2,8-9,14,17H,3,5-7,10H2,1H3 |
| InChIKey | SJZGCEVPFCMBEQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|