C13H15ClN4OS — CID 106048413
4-chloro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 106048413) has the molecular formula C13H15ClN4OS and a molecular weight of 310.81 g/mol. Its IUPAC name is 4-chloro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 106048413 |
| Molecular Formula | C13H15ClN4OS |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-chloro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCCc2csc(C)n2)c(Cl)c1=O |
| InChI | InChI=1S/C13H15ClN4OS/c1-3-6-18-13(19)12(14)11(7-16-18)15-5-4-10-8-20-9(2)17-10/h3,7-8,15H,1,4-6H2,2H3 |
| InChIKey | VFDCJUKUFIFEQT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|