C11H13BrN4O2S2 — CID 106049811
N-[2-(5-bromothiophen-2-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 106049811) has the molecular formula C11H13BrN4O2S2 and a molecular weight of 377.29 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 106049811 |
| Molecular Formula | C11H13BrN4O2S2 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NCCc2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C11H13BrN4O2S2/c1-13-11-14-6-9(7-15-11)20(17,18)16-5-4-8-2-3-10(12)19-8/h2-3,6-7,16H,4-5H2,1H3,(H,13,14,15) |
| InChIKey | CBBICECRESUCRR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |