C14H20N2O2S3 — CID 106050209
4-methyl-2-(methylaminomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 106050209) has the molecular formula C14H20N2O2S3 and a molecular weight of 344.53 g/mol. Its IUPAC name is 4-methyl-2-(methylaminomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 4-methyl-2-(methylaminomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106050209 |
| Molecular Formula | C14H20N2O2S3 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-methyl-2-(methylaminomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | CNCc1scc(C)c1S(=O)(=O)NC(C)c1ccc(C)s1 |
| InChI | InChI=1S/C14H20N2O2S3/c1-9-8-19-13(7-15-4)14(9)21(17,18)16-11(3)12-6-5-10(2)20-12/h5-6,8,11,15-16H,7H2,1-4H3 |
| InChIKey | VIIIIHURTXTRPA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |