C14H24N2O2S — CID 106055066
4-(methylamino)-N-(1-phenylpropyl)butane-1-sulfonamide (PubChem CID 106055066) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 4-(methylamino)-N-(1-phenylpropyl)butane-1-sulfonamide.
| Compound Name | 4-(methylamino)-N-(1-phenylpropyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106055066 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-(methylamino)-N-(1-phenylpropyl)butane-1-sulfonamide |
| SMILES | CCC(NS(=O)(=O)CCCCNC)c1ccccc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-3-14(13-9-5-4-6-10-13)16-19(17,18)12-8-7-11-15-2/h4-6,9-10,14-16H,3,7-8,11-12H2,1-2H3 |
| InChIKey | UUCRZUXQWJUNBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|