C19H25NO2S — CID 60580802
N-(1,4-diphenylbutyl)propane-1-sulfonamide (PubChem CID 60580802) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is N-(1,4-diphenylbutyl)propane-1-sulfonamide.
| Compound Name | N-(1,4-diphenylbutyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60580802 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(1,4-diphenylbutyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC(CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2S/c1-2-16-23(21,22)20-19(18-13-7-4-8-14-18)15-9-12-17-10-5-3-6-11-17/h3-8,10-11,13-14,19-20H,2,9,12,15-16H2,1H3 |
| InChIKey | JNDQNCRAICTECN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |