C13H19ClN2O3S — CID 106059597
N-(5-chloro-2-methoxyphenyl)-1-(cyclopropylamino)propane-2-sulfonamide (PubChem CID 106059597) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-1-(cyclopropylamino)propane-2-sulfonamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-1-(cyclopropylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106059597 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-1-(cyclopropylamino)propane-2-sulfonamide |
| SMILES | COc1ccc(Cl)cc1NS(=O)(=O)C(C)CNC1CC1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-9(8-15-11-4-5-11)20(17,18)16-12-7-10(14)3-6-13(12)19-2/h3,6-7,9,11,15-16H,4-5,8H2,1-2H3 |
| InChIKey | UOYLVJIDNVJJIR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |