C12H17ClN2O — CID 116935148
1-(5-chloro-2-methoxyphenyl)-N'-cyclopropylethane-1,2-diamine (PubChem CID 116935148) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N'-cyclopropylethane-1,2-diamine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N'-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 116935148 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N'-cyclopropylethane-1,2-diamine |
| SMILES | COc1ccc(Cl)cc1C(N)CNC1CC1 |
| InChI | InChI=1S/C12H17ClN2O/c1-16-12-5-2-8(13)6-10(12)11(14)7-15-9-3-4-9/h2,5-6,9,11,15H,3-4,7,14H2,1H3 |
| InChIKey | YWKXADAQZYYGMO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |