C11H20N4O4S2 — CID 106059803
N-(1,1-dioxothiolan-3-yl)-1-[3-(methylamino)propyl]pyrazole-4-sulfonamide (PubChem CID 106059803) has the molecular formula C11H20N4O4S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-[3-(methylamino)propyl]pyrazole-4-sulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-[3-(methylamino)propyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106059803 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-[3-(methylamino)propyl]pyrazole-4-sulfonamide |
| SMILES | CNCCCn1cc(S(=O)(=O)NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C11H20N4O4S2/c1-12-4-2-5-15-8-11(7-13-15)21(18,19)14-10-3-6-20(16,17)9-10/h7-8,10,12,14H,2-6,9H2,1H3 |
| InChIKey | YKSMKQVHCCTJAV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|