C10H18N4O2S2 — CID 114142410
1-[2-(methylamino)ethyl]-N-(thiolan-3-yl)pyrazole-4-sulfonamide (PubChem CID 114142410) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-N-(thiolan-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[2-(methylamino)ethyl]-N-(thiolan-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114142410 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-N-(thiolan-3-yl)pyrazole-4-sulfonamide |
| SMILES | CNCCn1cc(S(=O)(=O)NC2CCSC2)cn1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-11-3-4-14-7-10(6-12-14)18(15,16)13-9-2-5-17-8-9/h6-7,9,11,13H,2-5,8H2,1H3 |
| InChIKey | UUMACNKTXBQFKM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |