C13H25N5O2S — CID 106094169
N-[2-[cyclopropyl(methyl)amino]propyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide (PubChem CID 106094169) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[2-[cyclopropyl(methyl)amino]propyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide.
| Compound Name | N-[2-[cyclopropyl(methyl)amino]propyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106094169 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[2-[cyclopropyl(methyl)amino]propyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
| SMILES | CNCCn1cc(S(=O)(=O)NCC(C)N(C)C2CC2)cn1 |
| InChI | InChI=1S/C13H25N5O2S/c1-11(17(3)12-4-5-12)8-16-21(19,20)13-9-15-18(10-13)7-6-14-2/h9-12,14,16H,4-8H2,1-3H3 |
| InChIKey | FNWUPYQPNZEELB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |