C11H22N4O2S2 — CID 106083375
N-(1-ethylsulfanylpropan-2-yl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide (PubChem CID 106083375) has the molecular formula C11H22N4O2S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is N-(1-ethylsulfanylpropan-2-yl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide.
| Compound Name | N-(1-ethylsulfanylpropan-2-yl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106083375 |
| Molecular Formula | C11H22N4O2S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(1-ethylsulfanylpropan-2-yl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCSCC(C)NS(=O)(=O)c1cnn(CCNC)c1 |
| InChI | InChI=1S/C11H22N4O2S2/c1-4-18-9-10(2)14-19(16,17)11-7-13-15(8-11)6-5-12-3/h7-8,10,12,14H,4-6,9H2,1-3H3 |
| InChIKey | WWNMWSHVEWUPKL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |