C14H28N4O2S — CID 106053678
1-[3-(ethylamino)propyl]-N-(3-methylpentan-2-yl)pyrazole-4-sulfonamide (PubChem CID 106053678) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-[3-(ethylamino)propyl]-N-(3-methylpentan-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[3-(ethylamino)propyl]-N-(3-methylpentan-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106053678 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[3-(ethylamino)propyl]-N-(3-methylpentan-2-yl)pyrazole-4-sulfonamide |
| SMILES | CCNCCCn1cc(S(=O)(=O)NC(C)C(C)CC)cn1 |
| InChI | InChI=1S/C14H28N4O2S/c1-5-12(3)13(4)17-21(19,20)14-10-16-18(11-14)9-7-8-15-6-2/h10-13,15,17H,5-9H2,1-4H3 |
| InChIKey | UUVOZSBOQFLDKP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|