C12H21N3O4S — CID 61463326
3-[4-(3-methylpentan-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid (PubChem CID 61463326) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-[4-(3-methylpentan-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-(3-methylpentan-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 61463326 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-[4-(3-methylpentan-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid |
| SMILES | CCC(C)C(C)NS(=O)(=O)c1cnn(CCC(=O)O)c1 |
| InChI | InChI=1S/C12H21N3O4S/c1-4-9(2)10(3)14-20(18,19)11-7-13-15(8-11)6-5-12(16)17/h7-10,14H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | PMCDMXJTIJMTOU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |