C12H17ClN4O2S2 — CID 106003980
N-[1-(5-chlorothiophen-2-yl)ethyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide (PubChem CID 106003980) has the molecular formula C12H17ClN4O2S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106003980 |
| Molecular Formula | C12H17ClN4O2S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
| SMILES | CNCCn1cc(S(=O)(=O)NC(C)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C12H17ClN4O2S2/c1-9(11-3-4-12(13)20-11)16-21(18,19)10-7-15-17(8-10)6-5-14-2/h3-4,7-9,14,16H,5-6H2,1-2H3 |
| InChIKey | NBDXLSUJFCFEFN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |