C13H11ClF3NO3S2 — CID 46406797
N-[1-(5-chlorothiophen-2-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 46406797) has the molecular formula C13H11ClF3NO3S2 and a molecular weight of 385.82 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 46406797 |
| Molecular Formula | C13H11ClF3NO3S2 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H11ClF3NO3S2/c1-8(11-6-7-12(14)22-11)18-23(19,20)10-4-2-9(3-5-10)21-13(15,16)17/h2-8,18H,1H3 |
| InChIKey | MYWKECXYRGBZSR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |