C13H20BrN3O2S — CID 106061253
N-(2-bromophenyl)-3-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106061253) has the molecular formula C13H20BrN3O2S and a molecular weight of 362.29 g/mol. Its IUPAC name is N-(2-bromophenyl)-3-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(2-bromophenyl)-3-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106061253 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-(2-bromophenyl)-3-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCCN(S(=O)(=O)Nc2ccccc2Br)C1 |
| InChI | InChI=1S/C13H20BrN3O2S/c1-15-9-11-5-4-8-17(10-11)20(18,19)16-13-7-3-2-6-12(13)14/h2-3,6-7,11,15-16H,4-5,8-10H2,1H3 |
| InChIKey | YKWROGYKMSGXLY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |