C12H20N2O3S2 — CID 106063055
4-(methylaminomethyl)-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide (PubChem CID 106063055) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106063055 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-(methylaminomethyl)-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CNCc1csc(S(=O)(=O)NCC2CCOCC2)c1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-13-7-11-6-12(18-9-11)19(15,16)14-8-10-2-4-17-5-3-10/h6,9-10,13-14H,2-5,7-8H2,1H3 |
| InChIKey | ALVOJIUZACLTMO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |