C9H14N2O3S2 — CID 61300759
4-amino-N-(oxolan-3-ylmethyl)thiophene-2-sulfonamide (PubChem CID 61300759) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-amino-N-(oxolan-3-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(oxolan-3-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61300759 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-amino-N-(oxolan-3-ylmethyl)thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)NCC2CCOC2)c1 |
| InChI | InChI=1S/C9H14N2O3S2/c10-8-3-9(15-6-8)16(12,13)11-4-7-1-2-14-5-7/h3,6-7,11H,1-2,4-5,10H2 |
| InChIKey | UKRWXLDZQXALTL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |