C11H17F3N2O3S2 — CID 106064612
4-methyl-2-(methylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide (PubChem CID 106064612) has the molecular formula C11H17F3N2O3S2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 4-methyl-2-(methylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide.
| Compound Name | 4-methyl-2-(methylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106064612 |
| Molecular Formula | C11H17F3N2O3S2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-methyl-2-(methylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide |
| SMILES | CNCc1scc(C)c1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3S2/c1-8-6-20-9(5-15-2)10(8)21(17,18)16-3-4-19-7-11(12,13)14/h6,15-16H,3-5,7H2,1-2H3 |
| InChIKey | YYFWKLGCKUUNBV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|